C14H14Cl2N2 — CID 79780865
(3,5-dichloro-2-pyridinyl)-(2,4-dimethylphenyl)methanamine (PubChem CID 79780865) has the molecular formula C14H14Cl2N2 and a molecular weight of 281.19 g/mol. Its IUPAC name is (3,5-dichloro-2-pyridinyl)-(2,4-dimethylphenyl)methanamine.
| Compound Name | (3,5-dichloro-2-pyridinyl)-(2,4-dimethylphenyl)methanamine |
|---|---|
| PubChem CID | 79780865 |
| Molecular Formula | C14H14Cl2N2 |
| Molecular Weight | 281.19 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | (3,5-dichloro-2-pyridinyl)-(2,4-dimethylphenyl)methanamine |
| SMILES | Cc1ccc(C(N)c2ncc(Cl)cc2Cl)c(C)c1 |
| InChI | InChI=1S/C14H14Cl2N2/c1-8-3-4-11(9(2)5-8)13(17)14-12(16)6-10(15)7-18-14/h3-7,13H,17H2,1-2H3 |
| InChIKey | WONXCGQVZVUXDG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.19 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |