C9H12Cl2N2 — CID 79780970
1-(3,5-dichloro-2-pyridinyl)-N-ethylethanamine (PubChem CID 79780970) has the molecular formula C9H12Cl2N2 and a molecular weight of 219.11 g/mol. Its IUPAC name is 1-(3,5-dichloro-2-pyridinyl)-N-ethylethanamine.
| Compound Name | 1-(3,5-dichloro-2-pyridinyl)-N-ethylethanamine |
|---|---|
| PubChem CID | 79780970 |
| Molecular Formula | C9H12Cl2N2 |
| Molecular Weight | 219.11 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 1-(3,5-dichloro-2-pyridinyl)-N-ethylethanamine |
| SMILES | CCNC(C)c1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C9H12Cl2N2/c1-3-12-6(2)9-8(11)4-7(10)5-13-9/h4-6,12H,3H2,1-2H3 |
| InChIKey | CZYIXUVFRSVOLH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.11 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |