C14H15Cl2N5 — CID 79781409
4-cyclohexyl-6-(3,5-dichloro-2-pyridinyl)-1,3,5-triazin-2-amine (PubChem CID 79781409) has the molecular formula C14H15Cl2N5 and a molecular weight of 324.22 g/mol. Its IUPAC name is 4-cyclohexyl-6-(3,5-dichloro-2-pyridinyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-cyclohexyl-6-(3,5-dichloro-2-pyridinyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 79781409 |
| Molecular Formula | C14H15Cl2N5 |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 4-cyclohexyl-6-(3,5-dichloro-2-pyridinyl)-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(-c2ncc(Cl)cc2Cl)nc(C2CCCCC2)n1 |
| InChI | InChI=1S/C14H15Cl2N5/c15-9-6-10(16)11(18-7-9)13-19-12(20-14(17)21-13)8-4-2-1-3-5-8/h6-8H,1-5H2,(H2,17,19,20,21) |
| InChIKey | NGRZIZAKYKJPHO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |