About 4-azido-1-methylpyrazole
4-azido-1-methylpyrazole (PubChem CID 79781561) has the molecular formula C4H5N5
and a molecular weight of 123.12 g/mol. Its IUPAC name is 4-azido-1-methylpyrazole.
Molecular Properties
| Compound Name | 4-azido-1-methylpyrazole |
| PubChem CID | 79781561 |
| Molecular Formula | C4H5N5 |
| Molecular Weight | 123.12 g/mol |
| Exact Mass | 123.05 |
| IUPAC Name | 4-azido-1-methylpyrazole |
| SMILES | Cn1cc(N=[N+]=[N-])cn1 |
| InChI | InChI=1S/C4H5N5/c1-9-3-4(2-6-9)7-8-5/h2-3H,1H3 |
| InChIKey | JOFDMQWZIPNZNK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 66.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.12 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-azido-1-methylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azido-1-methylpyrazole?
The IUPAC name of 4-azido-1-methylpyrazole (CID 79781561) is 4-azido-1-methylpyrazole.
What is the SMILES notation for 4-azido-1-methylpyrazole?
The canonical SMILES for 4-azido-1-methylpyrazole is Cn1cc(N=[N+]=[N-])cn1.
What is the InChIKey of 4-azido-1-methylpyrazole?
The InChIKey is JOFDMQWZIPNZNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N5/c1-9-3-4(2-6-9)7-8-5/h2-3H,1H3.
What are the key properties of 4-azido-1-methylpyrazole?
4-azido-1-methylpyrazole has a molecular weight of 123.12 g/mol, XLogP of 1.36, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azido-1-methylpyrazole is sourced from PubChem (CID 79781561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).