C15H24N2O3 — CID 79782868
butyl 2-[[6-[(propan-2-ylamino)methyl]-3-pyridinyl]oxy]acetate (PubChem CID 79782868) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is butyl 2-[[6-[(propan-2-ylamino)methyl]-3-pyridinyl]oxy]acetate.
| Compound Name | butyl 2-[[6-[(propan-2-ylamino)methyl]-3-pyridinyl]oxy]acetate |
|---|---|
| PubChem CID | 79782868 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | butyl 2-[[6-[(propan-2-ylamino)methyl]-3-pyridinyl]oxy]acetate |
| SMILES | CCCCOC(=O)COc1ccc(CNC(C)C)nc1 |
| InChI | InChI=1S/C15H24N2O3/c1-4-5-8-19-15(18)11-20-14-7-6-13(17-10-14)9-16-12(2)3/h6-7,10,12,16H,4-5,8-9,11H2,1-3H3 |
| InChIKey | SREQNNNFSPOWNY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|