C11H18N2O2 — CID 79782983
2-[[6-(propylaminomethyl)-3-pyridinyl]oxy]ethanol (PubChem CID 79782983) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-[[6-(propylaminomethyl)-3-pyridinyl]oxy]ethanol.
| Compound Name | 2-[[6-(propylaminomethyl)-3-pyridinyl]oxy]ethanol |
|---|---|
| PubChem CID | 79782983 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 2-[[6-(propylaminomethyl)-3-pyridinyl]oxy]ethanol |
| SMILES | CCCNCc1ccc(OCCO)cn1 |
| InChI | InChI=1S/C11H18N2O2/c1-2-5-12-8-10-3-4-11(9-13-10)15-7-6-14/h3-4,9,12,14H,2,5-8H2,1H3 |
| InChIKey | BCGGVNVWHRFOHC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|