C13H7Cl3N4O — CID 79783075
3-chloro-2-[3-(3,5-dichloro-2-pyridinyl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 79783075) has the molecular formula C13H7Cl3N4O and a molecular weight of 341.59 g/mol. Its IUPAC name is 3-chloro-2-[3-(3,5-dichloro-2-pyridinyl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 3-chloro-2-[3-(3,5-dichloro-2-pyridinyl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 79783075 |
| Molecular Formula | C13H7Cl3N4O |
| Molecular Weight | 341.59 g/mol |
| Exact Mass | 339.97 |
| IUPAC Name | 3-chloro-2-[3-(3,5-dichloro-2-pyridinyl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | Nc1cccc(Cl)c1-c1nc(-c2ncc(Cl)cc2Cl)no1 |
| InChI | InChI=1S/C13H7Cl3N4O/c14-6-4-8(16)11(18-5-6)12-19-13(21-20-12)10-7(15)2-1-3-9(10)17/h1-5H,17H2 |
| InChIKey | AAZRMYALXVBHJO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.59 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|