C17H16INO2 — CID 79783346
5-iodo-3-[(2,4,6-trimethylphenyl)methyl]-1,3-benzoxazol-2-one (PubChem CID 79783346) has the molecular formula C17H16INO2 and a molecular weight of 393.22 g/mol. Its IUPAC name is 5-iodo-3-[(2,4,6-trimethylphenyl)methyl]-1,3-benzoxazol-2-one.
| Compound Name | 5-iodo-3-[(2,4,6-trimethylphenyl)methyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 79783346 |
| Molecular Formula | C17H16INO2 |
| Molecular Weight | 393.22 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | 5-iodo-3-[(2,4,6-trimethylphenyl)methyl]-1,3-benzoxazol-2-one |
| SMILES | Cc1cc(C)c(Cn2c(=O)oc3ccc(I)cc32)c(C)c1 |
| InChI | InChI=1S/C17H16INO2/c1-10-6-11(2)14(12(3)7-10)9-19-15-8-13(18)4-5-16(15)21-17(19)20/h4-8H,9H2,1-3H3 |
| InChIKey | FXBUOPFUSKZUEC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.22 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|