About 6-cyclopropyl-2-(3,5-dichloro-2-pyridinyl)-N-propylpyrimidin-4-amine
6-cyclopropyl-2-(3,5-dichloro-2-pyridinyl)-N-propylpyrimidin-4-amine (PubChem CID 79784106) has the molecular formula C15H16Cl2N4
and a molecular weight of 323.23 g/mol. Its IUPAC name is 6-cyclopropyl-2-(3,5-dichloro-2-pyridinyl)-N-propylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-cyclopropyl-2-(3,5-dichloro-2-pyridinyl)-N-propylpyrimidin-4-amine |
| PubChem CID | 79784106 |
| Molecular Formula | C15H16Cl2N4 |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 6-cyclopropyl-2-(3,5-dichloro-2-pyridinyl)-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1cc(C2CC2)nc(-c2ncc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C15H16Cl2N4/c1-2-5-18-13-7-12(9-3-4-9)20-15(21-13)14-11(17)6-10(16)8-19-14/h6-9H,2-5H2,1H3,(H,18,20,21) |
| InChIKey | HROYVAWFSAWNHS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-cyclopropyl-2-(3,5-dichloro-2-pyridinyl)-N-propylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclopropyl-2-(3,5-dichloro-2-pyridinyl)-N-propylpyrimidin-4-amine?
The IUPAC name of 6-cyclopropyl-2-(3,5-dichloro-2-pyridinyl)-N-propylpyrimidin-4-amine (CID 79784106) is 6-cyclopropyl-2-(3,5-dichloro-2-pyridinyl)-N-propylpyrimidin-4-amine.
What is the SMILES notation for 6-cyclopropyl-2-(3,5-dichloro-2-pyridinyl)-N-propylpyrimidin-4-amine?
The canonical SMILES for 6-cyclopropyl-2-(3,5-dichloro-2-pyridinyl)-N-propylpyrimidin-4-amine is CCCNc1cc(C2CC2)nc(-c2ncc(Cl)cc2Cl)n1.
What is the InChIKey of 6-cyclopropyl-2-(3,5-dichloro-2-pyridinyl)-N-propylpyrimidin-4-amine?
The InChIKey is HROYVAWFSAWNHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16Cl2N4/c1-2-5-18-13-7-12(9-3-4-9)20-15(21-13)14-11(17)6-10(16)8-19-14/h6-9H,2-5H2,1H3,(H,18,20,21).
What are the key properties of 6-cyclopropyl-2-(3,5-dichloro-2-pyridinyl)-N-propylpyrimidin-4-amine?
6-cyclopropyl-2-(3,5-dichloro-2-pyridinyl)-N-propylpyrimidin-4-amine has a molecular weight of 323.23 g/mol, XLogP of 4.54, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclopropyl-2-(3,5-dichloro-2-pyridinyl)-N-propylpyrimidin-4-amine is sourced from PubChem (CID 79784106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).