About 3-(3-iodo-1,2,4-triazol-1-yl)thiolane 1,1-dioxide
3-(3-iodo-1,2,4-triazol-1-yl)thiolane 1,1-dioxide (PubChem CID 79784242) has the molecular formula C6H8IN3O2S
and a molecular weight of 313.12 g/mol. Its IUPAC name is 3-(3-iodo-1,2,4-triazol-1-yl)thiolane 1,1-dioxide.
Molecular Properties
| Compound Name | 3-(3-iodo-1,2,4-triazol-1-yl)thiolane 1,1-dioxide |
| PubChem CID | 79784242 |
| Molecular Formula | C6H8IN3O2S |
| Molecular Weight | 313.12 g/mol |
| Exact Mass | 312.94 |
| IUPAC Name | 3-(3-iodo-1,2,4-triazol-1-yl)thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(n2cnc(I)n2)C1 |
| InChI | InChI=1S/C6H8IN3O2S/c7-6-8-4-10(9-6)5-1-2-13(11,12)3-5/h4-5H,1-3H2 |
| InChIKey | BXDKPOPWJBUHAG-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.12 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-iodo-1,2,4-triazol-1-yl)thiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-iodo-1,2,4-triazol-1-yl)thiolane 1,1-dioxide?
The IUPAC name of 3-(3-iodo-1,2,4-triazol-1-yl)thiolane 1,1-dioxide (CID 79784242) is 3-(3-iodo-1,2,4-triazol-1-yl)thiolane 1,1-dioxide.
What is the SMILES notation for 3-(3-iodo-1,2,4-triazol-1-yl)thiolane 1,1-dioxide?
The canonical SMILES for 3-(3-iodo-1,2,4-triazol-1-yl)thiolane 1,1-dioxide is O=S1(=O)CCC(n2cnc(I)n2)C1.
What is the InChIKey of 3-(3-iodo-1,2,4-triazol-1-yl)thiolane 1,1-dioxide?
The InChIKey is BXDKPOPWJBUHAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8IN3O2S/c7-6-8-4-10(9-6)5-1-2-13(11,12)3-5/h4-5H,1-3H2.
What are the key properties of 3-(3-iodo-1,2,4-triazol-1-yl)thiolane 1,1-dioxide?
3-(3-iodo-1,2,4-triazol-1-yl)thiolane 1,1-dioxide has a molecular weight of 313.12 g/mol, XLogP of 0.24, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-iodo-1,2,4-triazol-1-yl)thiolane 1,1-dioxide is sourced from PubChem (CID 79784242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).