About 3-(3-iodo-1,2,4-triazol-1-yl)propanoic acid
3-(3-iodo-1,2,4-triazol-1-yl)propanoic acid (PubChem CID 79784338) has the molecular formula C5H6IN3O2
and a molecular weight of 267.03 g/mol. Its IUPAC name is 3-(3-iodo-1,2,4-triazol-1-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-(3-iodo-1,2,4-triazol-1-yl)propanoic acid |
| PubChem CID | 79784338 |
| Molecular Formula | C5H6IN3O2 |
| Molecular Weight | 267.03 g/mol |
| Exact Mass | 266.95 |
| IUPAC Name | 3-(3-iodo-1,2,4-triazol-1-yl)propanoic acid |
| SMILES | O=C(O)CCn1cnc(I)n1 |
| InChI | InChI=1S/C5H6IN3O2/c6-5-7-3-9(8-5)2-1-4(10)11/h3H,1-2H2,(H,10,11) |
| InChIKey | KDQHBFMMVPQWJG-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.03 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-iodo-1,2,4-triazol-1-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-iodo-1,2,4-triazol-1-yl)propanoic acid?
The IUPAC name of 3-(3-iodo-1,2,4-triazol-1-yl)propanoic acid (CID 79784338) is 3-(3-iodo-1,2,4-triazol-1-yl)propanoic acid.
What is the SMILES notation for 3-(3-iodo-1,2,4-triazol-1-yl)propanoic acid?
The canonical SMILES for 3-(3-iodo-1,2,4-triazol-1-yl)propanoic acid is O=C(O)CCn1cnc(I)n1.
What is the InChIKey of 3-(3-iodo-1,2,4-triazol-1-yl)propanoic acid?
The InChIKey is KDQHBFMMVPQWJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6IN3O2/c6-5-7-3-9(8-5)2-1-4(10)11/h3H,1-2H2,(H,10,11).
What are the key properties of 3-(3-iodo-1,2,4-triazol-1-yl)propanoic acid?
3-(3-iodo-1,2,4-triazol-1-yl)propanoic acid has a molecular weight of 267.03 g/mol, XLogP of 0.36, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-iodo-1,2,4-triazol-1-yl)propanoic acid is sourced from PubChem (CID 79784338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).