About 4-bromo-3-iodo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole
4-bromo-3-iodo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole (PubChem CID 79784518) has the molecular formula C7H7BrF3IN2O
and a molecular weight of 398.95 g/mol. Its IUPAC name is 4-bromo-3-iodo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole.
Molecular Properties
| Compound Name | 4-bromo-3-iodo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole |
| PubChem CID | 79784518 |
| Molecular Formula | C7H7BrF3IN2O |
| Molecular Weight | 398.95 g/mol |
| Exact Mass | 397.87 |
| IUPAC Name | 4-bromo-3-iodo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole |
| SMILES | FC(F)(F)COCCn1cc(Br)c(I)n1 |
| InChI | InChI=1S/C7H7BrF3IN2O/c8-5-3-14(13-6(5)12)1-2-15-4-7(9,10)11/h3H,1-2,4H2 |
| InChIKey | GUZYWWPTDTWESF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.95 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-3-iodo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3-iodo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole?
The IUPAC name of 4-bromo-3-iodo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole (CID 79784518) is 4-bromo-3-iodo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole.
What is the SMILES notation for 4-bromo-3-iodo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole?
The canonical SMILES for 4-bromo-3-iodo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole is FC(F)(F)COCCn1cc(Br)c(I)n1.
What is the InChIKey of 4-bromo-3-iodo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole?
The InChIKey is GUZYWWPTDTWESF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrF3IN2O/c8-5-3-14(13-6(5)12)1-2-15-4-7(9,10)11/h3H,1-2,4H2.
What are the key properties of 4-bromo-3-iodo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole?
4-bromo-3-iodo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole has a molecular weight of 398.95 g/mol, XLogP of 2.83, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3-iodo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazole is sourced from PubChem (CID 79784518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).