C10H6BrCl2IN2 — CID 79784613
4-bromo-1-[(2,6-dichlorophenyl)methyl]-3-iodopyrazole (PubChem CID 79784613) has the molecular formula C10H6BrCl2IN2 and a molecular weight of 431.89 g/mol. Its IUPAC name is 4-bromo-1-[(2,6-dichlorophenyl)methyl]-3-iodopyrazole.
| Compound Name | 4-bromo-1-[(2,6-dichlorophenyl)methyl]-3-iodopyrazole |
|---|---|
| PubChem CID | 79784613 |
| Molecular Formula | C10H6BrCl2IN2 |
| Molecular Weight | 431.89 g/mol |
| Exact Mass | 429.81 |
| IUPAC Name | 4-bromo-1-[(2,6-dichlorophenyl)methyl]-3-iodopyrazole |
| SMILES | Clc1cccc(Cl)c1Cn1cc(Br)c(I)n1 |
| InChI | InChI=1S/C10H6BrCl2IN2/c11-7-5-16(15-10(7)14)4-6-8(12)2-1-3-9(6)13/h1-3,5H,4H2 |
| InChIKey | IOUSUKQHRHDQAK-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.89 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|