About 5-iodo-2-(2,2,2-trifluoroethyl)isoindole-1,3-dione
5-iodo-2-(2,2,2-trifluoroethyl)isoindole-1,3-dione (PubChem CID 79785414) has the molecular formula C10H5F3INO2
and a molecular weight of 355.05 g/mol. Its IUPAC name is 5-iodo-2-(2,2,2-trifluoroethyl)isoindole-1,3-dione.
Molecular Properties
| Compound Name | 5-iodo-2-(2,2,2-trifluoroethyl)isoindole-1,3-dione |
| PubChem CID | 79785414 |
| Molecular Formula | C10H5F3INO2 |
| Molecular Weight | 355.05 g/mol |
| Exact Mass | 354.93 |
| IUPAC Name | 5-iodo-2-(2,2,2-trifluoroethyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccc(I)cc2C(=O)N1CC(F)(F)F |
| InChI | InChI=1S/C10H5F3INO2/c11-10(12,13)4-15-8(16)6-2-1-5(14)3-7(6)9(15)17/h1-3H,4H2 |
| InChIKey | IZKMEDHIUQWTDX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.05 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-2-(2,2,2-trifluoroethyl)isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-2-(2,2,2-trifluoroethyl)isoindole-1,3-dione?
The IUPAC name of 5-iodo-2-(2,2,2-trifluoroethyl)isoindole-1,3-dione (CID 79785414) is 5-iodo-2-(2,2,2-trifluoroethyl)isoindole-1,3-dione.
What is the SMILES notation for 5-iodo-2-(2,2,2-trifluoroethyl)isoindole-1,3-dione?
The canonical SMILES for 5-iodo-2-(2,2,2-trifluoroethyl)isoindole-1,3-dione is O=C1c2ccc(I)cc2C(=O)N1CC(F)(F)F.
What is the InChIKey of 5-iodo-2-(2,2,2-trifluoroethyl)isoindole-1,3-dione?
The InChIKey is IZKMEDHIUQWTDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5F3INO2/c11-10(12,13)4-15-8(16)6-2-1-5(14)3-7(6)9(15)17/h1-3H,4H2.
What are the key properties of 5-iodo-2-(2,2,2-trifluoroethyl)isoindole-1,3-dione?
5-iodo-2-(2,2,2-trifluoroethyl)isoindole-1,3-dione has a molecular weight of 355.05 g/mol, XLogP of 2.45, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-2-(2,2,2-trifluoroethyl)isoindole-1,3-dione is sourced from PubChem (CID 79785414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).