About 5-iodo-2-(oxan-4-ylmethyl)isoindole-1,3-dione
5-iodo-2-(oxan-4-ylmethyl)isoindole-1,3-dione (PubChem CID 79785699) has the molecular formula C14H14INO3
and a molecular weight of 371.17 g/mol. Its IUPAC name is 5-iodo-2-(oxan-4-ylmethyl)isoindole-1,3-dione.
Molecular Properties
| Compound Name | 5-iodo-2-(oxan-4-ylmethyl)isoindole-1,3-dione |
| PubChem CID | 79785699 |
| Molecular Formula | C14H14INO3 |
| Molecular Weight | 371.17 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | 5-iodo-2-(oxan-4-ylmethyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccc(I)cc2C(=O)N1CC1CCOCC1 |
| InChI | InChI=1S/C14H14INO3/c15-10-1-2-11-12(7-10)14(18)16(13(11)17)8-9-3-5-19-6-4-9/h1-2,7,9H,3-6,8H2 |
| InChIKey | AGGXNUAXDDDNER-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.17 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-2-(oxan-4-ylmethyl)isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-2-(oxan-4-ylmethyl)isoindole-1,3-dione?
The IUPAC name of 5-iodo-2-(oxan-4-ylmethyl)isoindole-1,3-dione (CID 79785699) is 5-iodo-2-(oxan-4-ylmethyl)isoindole-1,3-dione.
What is the SMILES notation for 5-iodo-2-(oxan-4-ylmethyl)isoindole-1,3-dione?
The canonical SMILES for 5-iodo-2-(oxan-4-ylmethyl)isoindole-1,3-dione is O=C1c2ccc(I)cc2C(=O)N1CC1CCOCC1.
What is the InChIKey of 5-iodo-2-(oxan-4-ylmethyl)isoindole-1,3-dione?
The InChIKey is AGGXNUAXDDDNER-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14INO3/c15-10-1-2-11-12(7-10)14(18)16(13(11)17)8-9-3-5-19-6-4-9/h1-2,7,9H,3-6,8H2.
What are the key properties of 5-iodo-2-(oxan-4-ylmethyl)isoindole-1,3-dione?
5-iodo-2-(oxan-4-ylmethyl)isoindole-1,3-dione has a molecular weight of 371.17 g/mol, XLogP of 2.31, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-2-(oxan-4-ylmethyl)isoindole-1,3-dione is sourced from PubChem (CID 79785699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).