About 4-chloro-3-iodo-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole
4-chloro-3-iodo-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole (PubChem CID 79785727) has the molecular formula C8H9ClF3IN2O
and a molecular weight of 368.52 g/mol. Its IUPAC name is 4-chloro-3-iodo-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole.
Molecular Properties
| Compound Name | 4-chloro-3-iodo-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole |
| PubChem CID | 79785727 |
| Molecular Formula | C8H9ClF3IN2O |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 367.94 |
| IUPAC Name | 4-chloro-3-iodo-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole |
| SMILES | FC(F)(F)COCCCn1cc(Cl)c(I)n1 |
| InChI | InChI=1S/C8H9ClF3IN2O/c9-6-4-15(14-7(6)13)2-1-3-16-5-8(10,11)12/h4H,1-3,5H2 |
| InChIKey | VWJWVHNFMRNTJM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3-iodo-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-iodo-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole?
The IUPAC name of 4-chloro-3-iodo-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole (CID 79785727) is 4-chloro-3-iodo-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole.
What is the SMILES notation for 4-chloro-3-iodo-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole?
The canonical SMILES for 4-chloro-3-iodo-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole is FC(F)(F)COCCCn1cc(Cl)c(I)n1.
What is the InChIKey of 4-chloro-3-iodo-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole?
The InChIKey is VWJWVHNFMRNTJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClF3IN2O/c9-6-4-15(14-7(6)13)2-1-3-16-5-8(10,11)12/h4H,1-3,5H2.
What are the key properties of 4-chloro-3-iodo-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole?
4-chloro-3-iodo-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole has a molecular weight of 368.52 g/mol, XLogP of 3.11, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-iodo-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrazole is sourced from PubChem (CID 79785727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).