About 2-ethyl-5,5-dimethyl-1-(1-methylpyrazol-3-yl)piperazine
2-ethyl-5,5-dimethyl-1-(1-methylpyrazol-3-yl)piperazine (PubChem CID 79785793) has the molecular formula C12H22N4
and a molecular weight of 222.34 g/mol. Its IUPAC name is 2-ethyl-5,5-dimethyl-1-(1-methylpyrazol-3-yl)piperazine.
Molecular Properties
| Compound Name | 2-ethyl-5,5-dimethyl-1-(1-methylpyrazol-3-yl)piperazine |
| PubChem CID | 79785793 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 2-ethyl-5,5-dimethyl-1-(1-methylpyrazol-3-yl)piperazine |
| SMILES | CCC1CNC(C)(C)CN1c1ccn(C)n1 |
| InChI | InChI=1S/C12H22N4/c1-5-10-8-13-12(2,3)9-16(10)11-6-7-15(4)14-11/h6-7,10,13H,5,8-9H2,1-4H3 |
| InChIKey | DEGWAJSUPKLNEP-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethyl-5,5-dimethyl-1-(1-methylpyrazol-3-yl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5,5-dimethyl-1-(1-methylpyrazol-3-yl)piperazine?
The IUPAC name of 2-ethyl-5,5-dimethyl-1-(1-methylpyrazol-3-yl)piperazine (CID 79785793) is 2-ethyl-5,5-dimethyl-1-(1-methylpyrazol-3-yl)piperazine.
What is the SMILES notation for 2-ethyl-5,5-dimethyl-1-(1-methylpyrazol-3-yl)piperazine?
The canonical SMILES for 2-ethyl-5,5-dimethyl-1-(1-methylpyrazol-3-yl)piperazine is CCC1CNC(C)(C)CN1c1ccn(C)n1.
What is the InChIKey of 2-ethyl-5,5-dimethyl-1-(1-methylpyrazol-3-yl)piperazine?
The InChIKey is DEGWAJSUPKLNEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4/c1-5-10-8-13-12(2,3)9-16(10)11-6-7-15(4)14-11/h6-7,10,13H,5,8-9H2,1-4H3.
What are the key properties of 2-ethyl-5,5-dimethyl-1-(1-methylpyrazol-3-yl)piperazine?
2-ethyl-5,5-dimethyl-1-(1-methylpyrazol-3-yl)piperazine has a molecular weight of 222.34 g/mol, XLogP of 1.39, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5,5-dimethyl-1-(1-methylpyrazol-3-yl)piperazine is sourced from PubChem (CID 79785793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).