C16H23NO2 — CID 797864
2-(3,4-dimethylphenoxy)-1-(4-methylpiperidin-1-yl)ethanone (PubChem CID 797864) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 2-(3,4-dimethylphenoxy)-1-(4-methylpiperidin-1-yl)ethanone.
| Compound Name | 2-(3,4-dimethylphenoxy)-1-(4-methylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 797864 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 2-(3,4-dimethylphenoxy)-1-(4-methylpiperidin-1-yl)ethanone |
| SMILES | Cc1ccc(OCC(=O)N2CCC(C)CC2)cc1C |
| InChI | InChI=1S/C16H23NO2/c1-12-6-8-17(9-7-12)16(18)11-19-15-5-4-13(2)14(3)10-15/h4-5,10,12H,6-9,11H2,1-3H3 |
| InChIKey | FHWJCEAJGPSPJS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |