C12H11F3INO3 — CID 79787584
7-iodo-2-methyl-4-[2-(trifluoromethoxy)ethyl]-1,4-benzoxazin-3-one (PubChem CID 79787584) has the molecular formula C12H11F3INO3 and a molecular weight of 401.12 g/mol. Its IUPAC name is 7-iodo-2-methyl-4-[2-(trifluoromethoxy)ethyl]-1,4-benzoxazin-3-one.
| Compound Name | 7-iodo-2-methyl-4-[2-(trifluoromethoxy)ethyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 79787584 |
| Molecular Formula | C12H11F3INO3 |
| Molecular Weight | 401.12 g/mol |
| Exact Mass | 400.97 |
| IUPAC Name | 7-iodo-2-methyl-4-[2-(trifluoromethoxy)ethyl]-1,4-benzoxazin-3-one |
| SMILES | CC1Oc2cc(I)ccc2N(CCOC(F)(F)F)C1=O |
| InChI | InChI=1S/C12H11F3INO3/c1-7-11(18)17(4-5-19-12(13,14)15)9-3-2-8(16)6-10(9)20-7/h2-3,6-7H,4-5H2,1H3 |
| InChIKey | PFTXUIJNILJNEN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.12 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|