About 7-iodo-2-propyl-3,4-dihydroisoquinolin-1-one
7-iodo-2-propyl-3,4-dihydroisoquinolin-1-one (PubChem CID 79787698) has the molecular formula C12H14INO
and a molecular weight of 315.15 g/mol. Its IUPAC name is 7-iodo-2-propyl-3,4-dihydroisoquinolin-1-one.
Molecular Properties
| Compound Name | 7-iodo-2-propyl-3,4-dihydroisoquinolin-1-one |
| PubChem CID | 79787698 |
| Molecular Formula | C12H14INO |
| Molecular Weight | 315.15 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | 7-iodo-2-propyl-3,4-dihydroisoquinolin-1-one |
| SMILES | CCCN1CCc2ccc(I)cc2C1=O |
| InChI | InChI=1S/C12H14INO/c1-2-6-14-7-5-9-3-4-10(13)8-11(9)12(14)15/h3-4,8H,2,5-7H2,1H3 |
| InChIKey | SPZDYBMBNYMDSH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.15 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7-iodo-2-propyl-3,4-dihydroisoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-iodo-2-propyl-3,4-dihydroisoquinolin-1-one?
The IUPAC name of 7-iodo-2-propyl-3,4-dihydroisoquinolin-1-one (CID 79787698) is 7-iodo-2-propyl-3,4-dihydroisoquinolin-1-one.
What is the SMILES notation for 7-iodo-2-propyl-3,4-dihydroisoquinolin-1-one?
The canonical SMILES for 7-iodo-2-propyl-3,4-dihydroisoquinolin-1-one is CCCN1CCc2ccc(I)cc2C1=O.
What is the InChIKey of 7-iodo-2-propyl-3,4-dihydroisoquinolin-1-one?
The InChIKey is SPZDYBMBNYMDSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14INO/c1-2-6-14-7-5-9-3-4-10(13)8-11(9)12(14)15/h3-4,8H,2,5-7H2,1H3.
What are the key properties of 7-iodo-2-propyl-3,4-dihydroisoquinolin-1-one?
7-iodo-2-propyl-3,4-dihydroisoquinolin-1-one has a molecular weight of 315.15 g/mol, XLogP of 2.70, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-iodo-2-propyl-3,4-dihydroisoquinolin-1-one is sourced from PubChem (CID 79787698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).