About 1-hexyl-7-iodo-4,5-dihydro-3H-1-benzazepin-2-one
1-hexyl-7-iodo-4,5-dihydro-3H-1-benzazepin-2-one (PubChem CID 79787898) has the molecular formula C16H22INO
and a molecular weight of 371.26 g/mol. Its IUPAC name is 1-hexyl-7-iodo-4,5-dihydro-3H-1-benzazepin-2-one.
Molecular Properties
| Compound Name | 1-hexyl-7-iodo-4,5-dihydro-3H-1-benzazepin-2-one |
| PubChem CID | 79787898 |
| Molecular Formula | C16H22INO |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 1-hexyl-7-iodo-4,5-dihydro-3H-1-benzazepin-2-one |
| SMILES | CCCCCCN1C(=O)CCCc2cc(I)ccc21 |
| InChI | InChI=1S/C16H22INO/c1-2-3-4-5-11-18-15-10-9-14(17)12-13(15)7-6-8-16(18)19/h9-10,12H,2-8,11H2,1H3 |
| InChIKey | IKFWLFYTHURLRI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-hexyl-7-iodo-4,5-dihydro-3H-1-benzazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexyl-7-iodo-4,5-dihydro-3H-1-benzazepin-2-one?
The IUPAC name of 1-hexyl-7-iodo-4,5-dihydro-3H-1-benzazepin-2-one (CID 79787898) is 1-hexyl-7-iodo-4,5-dihydro-3H-1-benzazepin-2-one.
What is the SMILES notation for 1-hexyl-7-iodo-4,5-dihydro-3H-1-benzazepin-2-one?
The canonical SMILES for 1-hexyl-7-iodo-4,5-dihydro-3H-1-benzazepin-2-one is CCCCCCN1C(=O)CCCc2cc(I)ccc21.
What is the InChIKey of 1-hexyl-7-iodo-4,5-dihydro-3H-1-benzazepin-2-one?
The InChIKey is IKFWLFYTHURLRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22INO/c1-2-3-4-5-11-18-15-10-9-14(17)12-13(15)7-6-8-16(18)19/h9-10,12H,2-8,11H2,1H3.
What are the key properties of 1-hexyl-7-iodo-4,5-dihydro-3H-1-benzazepin-2-one?
1-hexyl-7-iodo-4,5-dihydro-3H-1-benzazepin-2-one has a molecular weight of 371.26 g/mol, XLogP of 4.54, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexyl-7-iodo-4,5-dihydro-3H-1-benzazepin-2-one is sourced from PubChem (CID 79787898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).