About [5-(1,2,4-oxadiazol-3-ylmethoxy)-2-pyridinyl]methanamine
[5-(1,2,4-oxadiazol-3-ylmethoxy)-2-pyridinyl]methanamine (PubChem CID 79788312) has the molecular formula C9H10N4O2
and a molecular weight of 206.20 g/mol. Its IUPAC name is [5-(1,2,4-oxadiazol-3-ylmethoxy)-2-pyridinyl]methanamine.
Molecular Properties
| Compound Name | [5-(1,2,4-oxadiazol-3-ylmethoxy)-2-pyridinyl]methanamine |
| PubChem CID | 79788312 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | [5-(1,2,4-oxadiazol-3-ylmethoxy)-2-pyridinyl]methanamine |
| SMILES | NCc1ccc(OCc2ncon2)cn1 |
| InChI | InChI=1S/C9H10N4O2/c10-3-7-1-2-8(4-11-7)14-5-9-12-6-15-13-9/h1-2,4,6H,3,5,10H2 |
| InChIKey | STNVNYKCTWORQQ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [5-(1,2,4-oxadiazol-3-ylmethoxy)-2-pyridinyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(1,2,4-oxadiazol-3-ylmethoxy)-2-pyridinyl]methanamine?
The IUPAC name of [5-(1,2,4-oxadiazol-3-ylmethoxy)-2-pyridinyl]methanamine (CID 79788312) is [5-(1,2,4-oxadiazol-3-ylmethoxy)-2-pyridinyl]methanamine.
What is the SMILES notation for [5-(1,2,4-oxadiazol-3-ylmethoxy)-2-pyridinyl]methanamine?
The canonical SMILES for [5-(1,2,4-oxadiazol-3-ylmethoxy)-2-pyridinyl]methanamine is NCc1ccc(OCc2ncon2)cn1.
What is the InChIKey of [5-(1,2,4-oxadiazol-3-ylmethoxy)-2-pyridinyl]methanamine?
The InChIKey is STNVNYKCTWORQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O2/c10-3-7-1-2-8(4-11-7)14-5-9-12-6-15-13-9/h1-2,4,6H,3,5,10H2.
What are the key properties of [5-(1,2,4-oxadiazol-3-ylmethoxy)-2-pyridinyl]methanamine?
[5-(1,2,4-oxadiazol-3-ylmethoxy)-2-pyridinyl]methanamine has a molecular weight of 206.20 g/mol, XLogP of 0.50, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(1,2,4-oxadiazol-3-ylmethoxy)-2-pyridinyl]methanamine is sourced from PubChem (CID 79788312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).