C15H26N2O3S — CID 79788512
N-[[5-(3-ethylsulfonylpropoxy)-2-pyridinyl]methyl]-2-methylpropan-2-amine (PubChem CID 79788512) has the molecular formula C15H26N2O3S and a molecular weight of 314.45 g/mol. Its IUPAC name is N-[[5-(3-ethylsulfonylpropoxy)-2-pyridinyl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[5-(3-ethylsulfonylpropoxy)-2-pyridinyl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 79788512 |
| Molecular Formula | C15H26N2O3S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | N-[[5-(3-ethylsulfonylpropoxy)-2-pyridinyl]methyl]-2-methylpropan-2-amine |
| SMILES | CCS(=O)(=O)CCCOc1ccc(CNC(C)(C)C)nc1 |
| InChI | InChI=1S/C15H26N2O3S/c1-5-21(18,19)10-6-9-20-14-8-7-13(16-12-14)11-17-15(2,3)4/h7-8,12,17H,5-6,9-11H2,1-4H3 |
| InChIKey | YIRSTAFITZVMSV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|