C16H26N2O3 — CID 79789241
2-methoxy-N-[[5-(3-methoxycyclohexyl)oxy-2-pyridinyl]methyl]ethanamine (PubChem CID 79789241) has the molecular formula C16H26N2O3 and a molecular weight of 294.40 g/mol. Its IUPAC name is 2-methoxy-N-[[5-(3-methoxycyclohexyl)oxy-2-pyridinyl]methyl]ethanamine.
| Compound Name | 2-methoxy-N-[[5-(3-methoxycyclohexyl)oxy-2-pyridinyl]methyl]ethanamine |
|---|---|
| PubChem CID | 79789241 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 2-methoxy-N-[[5-(3-methoxycyclohexyl)oxy-2-pyridinyl]methyl]ethanamine |
| SMILES | COCCNCc1ccc(OC2CCCC(OC)C2)cn1 |
| InChI | InChI=1S/C16H26N2O3/c1-19-9-8-17-11-13-6-7-16(12-18-13)21-15-5-3-4-14(10-15)20-2/h6-7,12,14-15,17H,3-5,8-11H2,1-2H3 |
| InChIKey | LYXZRVZUBGFAMK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|