C12H12F5NO2 — CID 79789387
2-methyl-2-[(2,3,4,5,6-pentafluorophenyl)methylamino]butanoic acid (PubChem CID 79789387) has the molecular formula C12H12F5NO2 and a molecular weight of 297.22 g/mol. Its IUPAC name is 2-methyl-2-[(2,3,4,5,6-pentafluorophenyl)methylamino]butanoic acid.
| Compound Name | 2-methyl-2-[(2,3,4,5,6-pentafluorophenyl)methylamino]butanoic acid |
|---|---|
| PubChem CID | 79789387 |
| Molecular Formula | C12H12F5NO2 |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 2-methyl-2-[(2,3,4,5,6-pentafluorophenyl)methylamino]butanoic acid |
| SMILES | CCC(C)(NCc1c(F)c(F)c(F)c(F)c1F)C(=O)O |
| InChI | InChI=1S/C12H12F5NO2/c1-3-12(2,11(19)20)18-4-5-6(13)8(15)10(17)9(16)7(5)14/h18H,3-4H2,1-2H3,(H,19,20) |
| InChIKey | JPCGNAMPVHQXLF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|