C13H15I3N2O3 — CID 79789607
2-methyl-2-[[2-oxo-2-(2,4,6-triiodoanilino)ethyl]amino]butanoic acid (PubChem CID 79789607) has the molecular formula C13H15I3N2O3 and a molecular weight of 627.99 g/mol. Its IUPAC name is 2-methyl-2-[[2-oxo-2-(2,4,6-triiodoanilino)ethyl]amino]butanoic acid.
| Compound Name | 2-methyl-2-[[2-oxo-2-(2,4,6-triiodoanilino)ethyl]amino]butanoic acid |
|---|---|
| PubChem CID | 79789607 |
| Molecular Formula | C13H15I3N2O3 |
| Molecular Weight | 627.99 g/mol |
| Exact Mass | 627.82 |
| IUPAC Name | 2-methyl-2-[[2-oxo-2-(2,4,6-triiodoanilino)ethyl]amino]butanoic acid |
| SMILES | CCC(C)(NCC(=O)Nc1c(I)cc(I)cc1I)C(=O)O |
| InChI | InChI=1S/C13H15I3N2O3/c1-3-13(2,12(20)21)17-6-10(19)18-11-8(15)4-7(14)5-9(11)16/h4-5,17H,3,6H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | UGHNCSJQBYDUPE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.99 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|