C13H19F3N2O3 — CID 79790532
2-[[2-(3-ethylpent-1-yn-3-ylamino)-2-oxoethyl]amino]-3,3,3-trifluoro-2-methylpropanoic acid (PubChem CID 79790532) has the molecular formula C13H19F3N2O3 and a molecular weight of 308.30 g/mol. Its IUPAC name is 2-[[2-(3-ethylpent-1-yn-3-ylamino)-2-oxoethyl]amino]-3,3,3-trifluoro-2-methylpropanoic acid.
| Compound Name | 2-[[2-(3-ethylpent-1-yn-3-ylamino)-2-oxoethyl]amino]-3,3,3-trifluoro-2-methylpropanoic acid |
|---|---|
| PubChem CID | 79790532 |
| Molecular Formula | C13H19F3N2O3 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-[[2-(3-ethylpent-1-yn-3-ylamino)-2-oxoethyl]amino]-3,3,3-trifluoro-2-methylpropanoic acid |
| SMILES | C#CC(CC)(CC)NC(=O)CNC(C)(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C13H19F3N2O3/c1-5-12(6-2,7-3)18-9(19)8-17-11(4,10(20)21)13(14,15)16/h1,17H,6-8H2,2-4H3,(H,18,19)(H,20,21) |
| InChIKey | HXLQXOFCJLVOFJ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|