C12H17F3N2O3 — CID 79790556
2-[[2-[bis(prop-2-enyl)amino]-2-oxoethyl]amino]-3,3,3-trifluoro-2-methylpropanoic acid (PubChem CID 79790556) has the molecular formula C12H17F3N2O3 and a molecular weight of 294.27 g/mol. Its IUPAC name is 2-[[2-[bis(prop-2-enyl)amino]-2-oxoethyl]amino]-3,3,3-trifluoro-2-methylpropanoic acid.
| Compound Name | 2-[[2-[bis(prop-2-enyl)amino]-2-oxoethyl]amino]-3,3,3-trifluoro-2-methylpropanoic acid |
|---|---|
| PubChem CID | 79790556 |
| Molecular Formula | C12H17F3N2O3 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-[[2-[bis(prop-2-enyl)amino]-2-oxoethyl]amino]-3,3,3-trifluoro-2-methylpropanoic acid |
| SMILES | C=CCN(CC=C)C(=O)CNC(C)(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C12H17F3N2O3/c1-4-6-17(7-5-2)9(18)8-16-11(3,10(19)20)12(13,14)15/h4-5,16H,1-2,6-8H2,3H3,(H,19,20) |
| InChIKey | APNAOSVXIADUPN-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|