C10H13F3N4O4 — CID 79790673
2-[(3-ethyl-1-methyl-4-nitropyrazol-5-yl)amino]-3,3,3-trifluoro-2-methylpropanoic acid (PubChem CID 79790673) has the molecular formula C10H13F3N4O4 and a molecular weight of 310.23 g/mol. Its IUPAC name is 2-[(3-ethyl-1-methyl-4-nitropyrazol-5-yl)amino]-3,3,3-trifluoro-2-methylpropanoic acid.
| Compound Name | 2-[(3-ethyl-1-methyl-4-nitropyrazol-5-yl)amino]-3,3,3-trifluoro-2-methylpropanoic acid |
|---|---|
| PubChem CID | 79790673 |
| Molecular Formula | C10H13F3N4O4 |
| Molecular Weight | 310.23 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 2-[(3-ethyl-1-methyl-4-nitropyrazol-5-yl)amino]-3,3,3-trifluoro-2-methylpropanoic acid |
| SMILES | CCc1nn(C)c(NC(C)(C(=O)O)C(F)(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H13F3N4O4/c1-4-5-6(17(20)21)7(16(3)15-5)14-9(2,8(18)19)10(11,12)13/h14H,4H2,1-3H3,(H,18,19) |
| InChIKey | AJIYPJVRLXQNQZ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.23 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|