C15H25N3O3 — CID 79790819
2-[[6-(2-aminobutyl)-3-pyridinyl]oxy]-N-(1-methoxypropan-2-yl)acetamide (PubChem CID 79790819) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is 2-[[6-(2-aminobutyl)-3-pyridinyl]oxy]-N-(1-methoxypropan-2-yl)acetamide.
| Compound Name | 2-[[6-(2-aminobutyl)-3-pyridinyl]oxy]-N-(1-methoxypropan-2-yl)acetamide |
|---|---|
| PubChem CID | 79790819 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 2-[[6-(2-aminobutyl)-3-pyridinyl]oxy]-N-(1-methoxypropan-2-yl)acetamide |
| SMILES | CCC(N)Cc1ccc(OCC(=O)NC(C)COC)cn1 |
| InChI | InChI=1S/C15H25N3O3/c1-4-12(16)7-13-5-6-14(8-17-13)21-10-15(19)18-11(2)9-20-3/h5-6,8,11-12H,4,7,9-10,16H2,1-3H3,(H,18,19) |
| InChIKey | UJSMAOHPEDKNAJ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |