C11H7F6N3O — CID 79791086
1,1,1-trifluoro-2-[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]propan-2-amine (PubChem CID 79791086) has the molecular formula C11H7F6N3O and a molecular weight of 311.19 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]propan-2-amine.
| Compound Name | 1,1,1-trifluoro-2-[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]propan-2-amine |
|---|---|
| PubChem CID | 79791086 |
| Molecular Formula | C11H7F6N3O |
| Molecular Weight | 311.19 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 1,1,1-trifluoro-2-[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]propan-2-amine |
| SMILES | CC(N)(c1nc(-c2cc(F)c(F)c(F)c2)no1)C(F)(F)F |
| InChI | InChI=1S/C11H7F6N3O/c1-10(18,11(15,16)17)9-19-8(20-21-9)4-2-5(12)7(14)6(13)3-4/h2-3H,18H2,1H3 |
| InChIKey | RRBQHHZVHAYCHF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.19 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|