C12H17F3N4O2 — CID 79791119
2-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-1,2,4-oxadiazol-5-yl]-1,1,1-trifluoropropan-2-amine (PubChem CID 79791119) has the molecular formula C12H17F3N4O2 and a molecular weight of 306.29 g/mol. Its IUPAC name is 2-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-1,2,4-oxadiazol-5-yl]-1,1,1-trifluoropropan-2-amine.
| Compound Name | 2-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-1,2,4-oxadiazol-5-yl]-1,1,1-trifluoropropan-2-amine |
|---|---|
| PubChem CID | 79791119 |
| Molecular Formula | C12H17F3N4O2 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 2-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-1,2,4-oxadiazol-5-yl]-1,1,1-trifluoropropan-2-amine |
| SMILES | CC(N)(c1nc(C2CN3CCCC3CO2)no1)C(F)(F)F |
| InChI | InChI=1S/C12H17F3N4O2/c1-11(16,12(13,14)15)10-17-9(18-21-10)8-5-19-4-2-3-7(19)6-20-8/h7-8H,2-6,16H2,1H3 |
| InChIKey | BJFGYNQOKIVMHO-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |