C20H19NO6S — CID 7979137
(5-methoxycarbonylfuran-2-yl)methyl (3R,7aS)-5-oxo-7a-phenyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 7979137) has the molecular formula C20H19NO6S and a molecular weight of 401.44 g/mol. Its IUPAC name is (5-methoxycarbonylfuran-2-yl)methyl (3R,7aS)-5-oxo-7a-phenyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | (5-methoxycarbonylfuran-2-yl)methyl (3R,7aS)-5-oxo-7a-phenyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 7979137 |
| Molecular Formula | C20H19NO6S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | (5-methoxycarbonylfuran-2-yl)methyl (3R,7aS)-5-oxo-7a-phenyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | COC(=O)c1ccc(COC(=O)[C@@H]2CS[C@]3(c4ccccc4)CCC(=O)N23)o1 |
| InChI | InChI=1S/C20H19NO6S/c1-25-19(24)16-8-7-14(27-16)11-26-18(23)15-12-28-20(10-9-17(22)21(15)20)13-5-3-2-4-6-13/h2-8,15H,9-12H2,1H3/t15-,20-/m0/s1 |
| InChIKey | DSPUJWJHFPTXOV-YWZLYKJASA-N |
| XLogP | 2.70 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |