C10H10F3N3O5 — CID 79791458
3,3,3-trifluoro-2-methyl-2-[(1-methyl-5-nitropyrrole-2-carbonyl)amino]propanoic acid (PubChem CID 79791458) has the molecular formula C10H10F3N3O5 and a molecular weight of 309.20 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-methyl-2-[(1-methyl-5-nitropyrrole-2-carbonyl)amino]propanoic acid.
| Compound Name | 3,3,3-trifluoro-2-methyl-2-[(1-methyl-5-nitropyrrole-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 79791458 |
| Molecular Formula | C10H10F3N3O5 |
| Molecular Weight | 309.20 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 3,3,3-trifluoro-2-methyl-2-[(1-methyl-5-nitropyrrole-2-carbonyl)amino]propanoic acid |
| SMILES | Cn1c(C(=O)NC(C)(C(=O)O)C(F)(F)F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10F3N3O5/c1-9(8(18)19,10(11,12)13)14-7(17)5-3-4-6(15(5)2)16(20)21/h3-4H,1-2H3,(H,14,17)(H,18,19) |
| InChIKey | HGTPUBMSXBXYPJ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.20 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|