About 2-(carbamoylamino)-3,3,3-trifluoro-2-methylpropanoic acid
2-(carbamoylamino)-3,3,3-trifluoro-2-methylpropanoic acid (PubChem CID 79792362) has the molecular formula C5H7F3N2O3
and a molecular weight of 200.12 g/mol. Its IUPAC name is 2-(carbamoylamino)-3,3,3-trifluoro-2-methylpropanoic acid.
Analyze 2-(carbamoylamino)-3,3,3-trifluoro-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(carbamoylamino)-3,3,3-trifluoro-2-methylpropanoic acid?
The IUPAC name of 2-(carbamoylamino)-3,3,3-trifluoro-2-methylpropanoic acid (CID 79792362) is 2-(carbamoylamino)-3,3,3-trifluoro-2-methylpropanoic acid.
What is the SMILES notation for 2-(carbamoylamino)-3,3,3-trifluoro-2-methylpropanoic acid?
The canonical SMILES for 2-(carbamoylamino)-3,3,3-trifluoro-2-methylpropanoic acid is CC(NC(N)=O)(C(=O)O)C(F)(F)F.
What is the InChIKey of 2-(carbamoylamino)-3,3,3-trifluoro-2-methylpropanoic acid?
The InChIKey is GYXLBRWJJUAQTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7F3N2O3/c1-4(2(11)12,5(6,7)8)10-3(9)13/h1H3,(H,11,12)(H3,9,10,13).
What are the key properties of 2-(carbamoylamino)-3,3,3-trifluoro-2-methylpropanoic acid?
2-(carbamoylamino)-3,3,3-trifluoro-2-methylpropanoic acid has a molecular weight of 200.12 g/mol, XLogP of 0.06, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(carbamoylamino)-3,3,3-trifluoro-2-methylpropanoic acid is sourced from PubChem (CID 79792362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).