C16H17NO4S — CID 7979334
2-oxopropyl (3R,7aS)-5-oxo-7a-phenyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 7979334) has the molecular formula C16H17NO4S and a molecular weight of 319.38 g/mol. Its IUPAC name is 2-oxopropyl (3R,7aS)-5-oxo-7a-phenyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | 2-oxopropyl (3R,7aS)-5-oxo-7a-phenyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 7979334 |
| Molecular Formula | C16H17NO4S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 2-oxopropyl (3R,7aS)-5-oxo-7a-phenyl-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | CC(=O)COC(=O)[C@@H]1CS[C@]2(c3ccccc3)CCC(=O)N12 |
| InChI | InChI=1S/C16H17NO4S/c1-11(18)9-21-15(20)13-10-22-16(8-7-14(19)17(13)16)12-5-3-2-4-6-12/h2-6,13H,7-10H2,1H3/t13-,16-/m0/s1 |
| InChIKey | OYFBYWJEYWKBQF-BBRMVZONSA-N |
| XLogP | 1.71 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |