C15H19BrN2OS — CID 79794186
N-[[5-[(3-bromothiophen-2-yl)methoxy]-2-pyridinyl]methyl]-2-methylpropan-2-amine (PubChem CID 79794186) has the molecular formula C15H19BrN2OS and a molecular weight of 355.30 g/mol. Its IUPAC name is N-[[5-[(3-bromothiophen-2-yl)methoxy]-2-pyridinyl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[5-[(3-bromothiophen-2-yl)methoxy]-2-pyridinyl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 79794186 |
| Molecular Formula | C15H19BrN2OS |
| Molecular Weight | 355.30 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | N-[[5-[(3-bromothiophen-2-yl)methoxy]-2-pyridinyl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1ccc(OCc2sccc2Br)cn1 |
| InChI | InChI=1S/C15H19BrN2OS/c1-15(2,3)18-8-11-4-5-12(9-17-11)19-10-14-13(16)6-7-20-14/h4-7,9,18H,8,10H2,1-3H3 |
| InChIKey | GUXGVUOXJWBXTE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.30 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |