C9H7F3INO3S — CID 79795737
3,3,3-trifluoro-2-[(5-iodothiophene-3-carbonyl)amino]-2-methylpropanoic acid (PubChem CID 79795737) has the molecular formula C9H7F3INO3S and a molecular weight of 393.12 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(5-iodothiophene-3-carbonyl)amino]-2-methylpropanoic acid.
| Compound Name | 3,3,3-trifluoro-2-[(5-iodothiophene-3-carbonyl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 79795737 |
| Molecular Formula | C9H7F3INO3S |
| Molecular Weight | 393.12 g/mol |
| Exact Mass | 392.91 |
| IUPAC Name | 3,3,3-trifluoro-2-[(5-iodothiophene-3-carbonyl)amino]-2-methylpropanoic acid |
| SMILES | CC(NC(=O)c1csc(I)c1)(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C9H7F3INO3S/c1-8(7(16)17,9(10,11)12)14-6(15)4-2-5(13)18-3-4/h2-3H,1H3,(H,14,15)(H,16,17) |
| InChIKey | RDZNZZQKAAVWLA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.12 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|