C11H10F3NO3 — CID 79795990
2-benzamido-3,3,3-trifluoro-2-methylpropanoic acid (PubChem CID 79795990) has the molecular formula C11H10F3NO3 and a molecular weight of 261.20 g/mol. Its IUPAC name is 2-benzamido-3,3,3-trifluoro-2-methylpropanoic acid.
| Compound Name | 2-benzamido-3,3,3-trifluoro-2-methylpropanoic acid |
|---|---|
| PubChem CID | 79795990 |
| Molecular Formula | C11H10F3NO3 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 2-benzamido-3,3,3-trifluoro-2-methylpropanoic acid |
| SMILES | CC(NC(=O)c1ccccc1)(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C11H10F3NO3/c1-10(9(17)18,11(12,13)14)15-8(16)7-5-3-2-4-6-7/h2-6H,1H3,(H,15,16)(H,17,18) |
| InChIKey | KDXMNSZLGGPXRQ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |