C10H13F3N2O4S — CID 79796070
3,3,3-trifluoro-2-methyl-2-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]propanoic acid (PubChem CID 79796070) has the molecular formula C10H13F3N2O4S and a molecular weight of 314.29 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-methyl-2-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]propanoic acid.
| Compound Name | 3,3,3-trifluoro-2-methyl-2-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 79796070 |
| Molecular Formula | C10H13F3N2O4S |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 3,3,3-trifluoro-2-methyl-2-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]propanoic acid |
| SMILES | CC(NC(=O)CCN1CCSC1=O)(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C10H13F3N2O4S/c1-9(7(17)18,10(11,12)13)14-6(16)2-3-15-4-5-20-8(15)19/h2-5H2,1H3,(H,14,16)(H,17,18) |
| InChIKey | YJDRBOUNJXMWJL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|