C7H14F3N3O3S — CID 79797166
2-amino-3,3,3-trifluoro-N-[2-(methanesulfonamido)ethyl]-2-methylpropanamide (PubChem CID 79797166) has the molecular formula C7H14F3N3O3S and a molecular weight of 277.27 g/mol. Its IUPAC name is 2-amino-3,3,3-trifluoro-N-[2-(methanesulfonamido)ethyl]-2-methylpropanamide.
| Compound Name | 2-amino-3,3,3-trifluoro-N-[2-(methanesulfonamido)ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 79797166 |
| Molecular Formula | C7H14F3N3O3S |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 2-amino-3,3,3-trifluoro-N-[2-(methanesulfonamido)ethyl]-2-methylpropanamide |
| SMILES | CC(N)(C(=O)NCCNS(C)(=O)=O)C(F)(F)F |
| InChI | InChI=1S/C7H14F3N3O3S/c1-6(11,7(8,9)10)5(14)12-3-4-13-17(2,15)16/h13H,3-4,11H2,1-2H3,(H,12,14) |
| InChIKey | NAFFWGDJQKAUJV-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|