C6H11F3N2O — CID 79797237
2-amino-3,3,3-trifluoro-N,N,2-trimethylpropanamide (PubChem CID 79797237) has the molecular formula C6H11F3N2O and a molecular weight of 184.16 g/mol. Its IUPAC name is 2-amino-3,3,3-trifluoro-N,N,2-trimethylpropanamide.
| Compound Name | 2-amino-3,3,3-trifluoro-N,N,2-trimethylpropanamide |
|---|---|
| PubChem CID | 79797237 |
| Molecular Formula | C6H11F3N2O |
| Molecular Weight | 184.16 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 2-amino-3,3,3-trifluoro-N,N,2-trimethylpropanamide |
| SMILES | CN(C)C(=O)C(C)(N)C(F)(F)F |
| InChI | InChI=1S/C6H11F3N2O/c1-5(10,6(7,8)9)4(12)11(2)3/h10H2,1-3H3 |
| InChIKey | JKLONKWXSCHMJL-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.16 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |