About (2-ethylcyclohexyl) 2-amino-3,3,3-trifluoro-2-methylpropanoate
(2-ethylcyclohexyl) 2-amino-3,3,3-trifluoro-2-methylpropanoate (PubChem CID 79797905) has the molecular formula C12H20F3NO2
and a molecular weight of 267.29 g/mol. Its IUPAC name is (2-ethylcyclohexyl) 2-amino-3,3,3-trifluoro-2-methylpropanoate.
Molecular Properties
| Compound Name | (2-ethylcyclohexyl) 2-amino-3,3,3-trifluoro-2-methylpropanoate |
| PubChem CID | 79797905 |
| Molecular Formula | C12H20F3NO2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | (2-ethylcyclohexyl) 2-amino-3,3,3-trifluoro-2-methylpropanoate |
| SMILES | CCC1CCCCC1OC(=O)C(C)(N)C(F)(F)F |
| InChI | InChI=1S/C12H20F3NO2/c1-3-8-6-4-5-7-9(8)18-10(17)11(2,16)12(13,14)15/h8-9H,3-7,16H2,1-2H3 |
| InChIKey | RRJNQGSKDNVGED-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-ethylcyclohexyl) 2-amino-3,3,3-trifluoro-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethylcyclohexyl) 2-amino-3,3,3-trifluoro-2-methylpropanoate?
The IUPAC name of (2-ethylcyclohexyl) 2-amino-3,3,3-trifluoro-2-methylpropanoate (CID 79797905) is (2-ethylcyclohexyl) 2-amino-3,3,3-trifluoro-2-methylpropanoate.
What is the SMILES notation for (2-ethylcyclohexyl) 2-amino-3,3,3-trifluoro-2-methylpropanoate?
The canonical SMILES for (2-ethylcyclohexyl) 2-amino-3,3,3-trifluoro-2-methylpropanoate is CCC1CCCCC1OC(=O)C(C)(N)C(F)(F)F.
What is the InChIKey of (2-ethylcyclohexyl) 2-amino-3,3,3-trifluoro-2-methylpropanoate?
The InChIKey is RRJNQGSKDNVGED-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20F3NO2/c1-3-8-6-4-5-7-9(8)18-10(17)11(2,16)12(13,14)15/h8-9H,3-7,16H2,1-2H3.
What are the key properties of (2-ethylcyclohexyl) 2-amino-3,3,3-trifluoro-2-methylpropanoate?
(2-ethylcyclohexyl) 2-amino-3,3,3-trifluoro-2-methylpropanoate has a molecular weight of 267.29 g/mol, XLogP of 2.78, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethylcyclohexyl) 2-amino-3,3,3-trifluoro-2-methylpropanoate is sourced from PubChem (CID 79797905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).