C9H14F3N3O2 — CID 79797984
1,1,1-trifluoro-2-[3-(propoxymethyl)-1,2,4-oxadiazol-5-yl]propan-2-amine (PubChem CID 79797984) has the molecular formula C9H14F3N3O2 and a molecular weight of 253.22 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-[3-(propoxymethyl)-1,2,4-oxadiazol-5-yl]propan-2-amine.
| Compound Name | 1,1,1-trifluoro-2-[3-(propoxymethyl)-1,2,4-oxadiazol-5-yl]propan-2-amine |
|---|---|
| PubChem CID | 79797984 |
| Molecular Formula | C9H14F3N3O2 |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 1,1,1-trifluoro-2-[3-(propoxymethyl)-1,2,4-oxadiazol-5-yl]propan-2-amine |
| SMILES | CCCOCc1noc(C(C)(N)C(F)(F)F)n1 |
| InChI | InChI=1S/C9H14F3N3O2/c1-3-4-16-5-6-14-7(17-15-6)8(2,13)9(10,11)12/h3-5,13H2,1-2H3 |
| InChIKey | UZYVPUIGDVBFJR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|