C9H11F3N4O4 — CID 79798891
2-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]-3,3,3-trifluoro-2-methylpropanoic acid (PubChem CID 79798891) has the molecular formula C9H11F3N4O4 and a molecular weight of 296.21 g/mol. Its IUPAC name is 2-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]-3,3,3-trifluoro-2-methylpropanoic acid.
| Compound Name | 2-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]-3,3,3-trifluoro-2-methylpropanoic acid |
|---|---|
| PubChem CID | 79798891 |
| Molecular Formula | C9H11F3N4O4 |
| Molecular Weight | 296.21 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 2-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]-3,3,3-trifluoro-2-methylpropanoic acid |
| SMILES | Cc1nn(C)c(NC(C)(C(=O)O)C(F)(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H11F3N4O4/c1-4-5(16(19)20)6(15(3)14-4)13-8(2,7(17)18)9(10,11)12/h13H,1-3H3,(H,17,18) |
| InChIKey | NJJLPNNIENCXJZ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.21 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|