C14H18ClN3O — CID 79800563
2-(chloromethyl)-5-[(1,3-diethylpyrazol-5-yl)methoxy]pyridine (PubChem CID 79800563) has the molecular formula C14H18ClN3O and a molecular weight of 279.77 g/mol. Its IUPAC name is 2-(chloromethyl)-5-[(1,3-diethylpyrazol-5-yl)methoxy]pyridine.
| Compound Name | 2-(chloromethyl)-5-[(1,3-diethylpyrazol-5-yl)methoxy]pyridine |
|---|---|
| PubChem CID | 79800563 |
| Molecular Formula | C14H18ClN3O |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 2-(chloromethyl)-5-[(1,3-diethylpyrazol-5-yl)methoxy]pyridine |
| SMILES | CCc1cc(COc2ccc(CCl)nc2)n(CC)n1 |
| InChI | InChI=1S/C14H18ClN3O/c1-3-11-7-13(18(4-2)17-11)10-19-14-6-5-12(8-15)16-9-14/h5-7,9H,3-4,8,10H2,1-2H3 |
| InChIKey | BXKBPLQEFIZLPG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|