C12H19F3N2O3 — CID 79801010
3,3,3-trifluoro-2-methyl-2-[(2,2,3,3-tetramethylcyclopropyl)carbamoylamino]propanoic acid (PubChem CID 79801010) has the molecular formula C12H19F3N2O3 and a molecular weight of 296.29 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-methyl-2-[(2,2,3,3-tetramethylcyclopropyl)carbamoylamino]propanoic acid.
| Compound Name | 3,3,3-trifluoro-2-methyl-2-[(2,2,3,3-tetramethylcyclopropyl)carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 79801010 |
| Molecular Formula | C12H19F3N2O3 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 3,3,3-trifluoro-2-methyl-2-[(2,2,3,3-tetramethylcyclopropyl)carbamoylamino]propanoic acid |
| SMILES | CC(NC(=O)NC1C(C)(C)C1(C)C)(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C12H19F3N2O3/c1-9(2)6(10(9,3)4)16-8(20)17-11(5,7(18)19)12(13,14)15/h6H,1-5H3,(H,18,19)(H2,16,17,20) |
| InChIKey | UEDQABRNENDDOG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |