C11H19F3N2O3 — CID 79801069
3,3,3-trifluoro-2-methyl-2-(4-methylpentylcarbamoylamino)propanoic acid (PubChem CID 79801069) has the molecular formula C11H19F3N2O3 and a molecular weight of 284.28 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-methyl-2-(4-methylpentylcarbamoylamino)propanoic acid.
| Compound Name | 3,3,3-trifluoro-2-methyl-2-(4-methylpentylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 79801069 |
| Molecular Formula | C11H19F3N2O3 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 3,3,3-trifluoro-2-methyl-2-(4-methylpentylcarbamoylamino)propanoic acid |
| SMILES | CC(C)CCCNC(=O)NC(C)(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C11H19F3N2O3/c1-7(2)5-4-6-15-9(19)16-10(3,8(17)18)11(12,13)14/h7H,4-6H2,1-3H3,(H,17,18)(H2,15,16,19) |
| InChIKey | DMKHSMHAULCMIR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|