About [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-methylbenzoate
[2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-methylbenzoate (PubChem CID 7980173) has the molecular formula C19H18N2O3
and a molecular weight of 322.36 g/mol. Its IUPAC name is [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-methylbenzoate.
Molecular Properties
| Compound Name | [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-methylbenzoate |
| PubChem CID | 7980173 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)N2CCC(c3ccccc3)=N2)cc1 |
| InChI | InChI=1S/C19H18N2O3/c1-14-7-9-16(10-8-14)19(23)24-13-18(22)21-12-11-17(20-21)15-5-3-2-4-6-15/h2-10H,11-13H2,1H3 |
| InChIKey | DCKUFPHVPPIJMX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-methylbenzoate?
The IUPAC name of [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-methylbenzoate (CID 7980173) is [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-methylbenzoate.
What is the SMILES notation for [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-methylbenzoate?
The canonical SMILES for [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-methylbenzoate is Cc1ccc(C(=O)OCC(=O)N2CCC(c3ccccc3)=N2)cc1.
What is the InChIKey of [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-methylbenzoate?
The InChIKey is DCKUFPHVPPIJMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O3/c1-14-7-9-16(10-8-14)19(23)24-13-18(22)21-12-11-17(20-21)15-5-3-2-4-6-15/h2-10H,11-13H2,1H3.
What are the key properties of [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-methylbenzoate?
[2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-methylbenzoate has a molecular weight of 322.36 g/mol, XLogP of 2.79, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-methylbenzoate is sourced from PubChem (CID 7980173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).