About 5-benzylsulfanyl-3H-1,3,4-thiadiazole-2-thione
5-benzylsulfanyl-3H-1,3,4-thiadiazole-2-thione (PubChem CID 798021) has the molecular formula C9H8N2S3
and a molecular weight of 240.38 g/mol. Its IUPAC name is 5-benzylsulfanyl-3H-1,3,4-thiadiazole-2-thione.
Molecular Properties
| Compound Name | 5-benzylsulfanyl-3H-1,3,4-thiadiazole-2-thione |
| PubChem CID | 798021 |
| Molecular Formula | C9H8N2S3 |
| Molecular Weight | 240.38 g/mol |
| Exact Mass | 239.98 |
| IUPAC Name | 5-benzylsulfanyl-3H-1,3,4-thiadiazole-2-thione |
| SMILES | S=c1[nH]nc(SCc2ccccc2)s1 |
| InChI | InChI=1S/C9H8N2S3/c12-8-10-11-9(14-8)13-6-7-4-2-1-3-5-7/h1-5H,6H2,(H,10,12) |
| InChIKey | UBLXSSRRVRLOEO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-benzylsulfanyl-3H-1,3,4-thiadiazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzylsulfanyl-3H-1,3,4-thiadiazole-2-thione?
The IUPAC name of 5-benzylsulfanyl-3H-1,3,4-thiadiazole-2-thione (CID 798021) is 5-benzylsulfanyl-3H-1,3,4-thiadiazole-2-thione.
What is the SMILES notation for 5-benzylsulfanyl-3H-1,3,4-thiadiazole-2-thione?
The canonical SMILES for 5-benzylsulfanyl-3H-1,3,4-thiadiazole-2-thione is S=c1[nH]nc(SCc2ccccc2)s1.
What is the InChIKey of 5-benzylsulfanyl-3H-1,3,4-thiadiazole-2-thione?
The InChIKey is UBLXSSRRVRLOEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2S3/c12-8-10-11-9(14-8)13-6-7-4-2-1-3-5-7/h1-5H,6H2,(H,10,12).
What are the key properties of 5-benzylsulfanyl-3H-1,3,4-thiadiazole-2-thione?
5-benzylsulfanyl-3H-1,3,4-thiadiazole-2-thione has a molecular weight of 240.38 g/mol, XLogP of 3.49, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzylsulfanyl-3H-1,3,4-thiadiazole-2-thione is sourced from PubChem (CID 798021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).